About (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane
(3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane (PubChem CID 121421961) has the molecular formula C12H22F2O
and a molecular weight of 220.30 g/mol. Its IUPAC name is (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane.
Molecular Properties
| Compound Name | (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane |
| PubChem CID | 121421961 |
| Molecular Formula | C12H22F2O |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane |
| SMILES | CC(C)[C@H]1COCC[C@]1(C(C)C)C(F)F |
| InChI | InChI=1S/C12H22F2O/c1-8(2)10-7-15-6-5-12(10,9(3)4)11(13)14/h8-11H,5-7H2,1-4H3/t10-,12-/m1/s1 |
| InChIKey | GHHKDRRBZIIKIN-ZYHUDNBSSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane?
The IUPAC name of (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane (CID 121421961) is (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane.
What is the SMILES notation for (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane?
The canonical SMILES for (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane is CC(C)[C@H]1COCC[C@]1(C(C)C)C(F)F.
What is the InChIKey of (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane?
The InChIKey is GHHKDRRBZIIKIN-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H22F2O/c1-8(2)10-7-15-6-5-12(10,9(3)4)11(13)14/h8-11H,5-7H2,1-4H3/t10-,12-/m1/s1.
What are the key properties of (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane?
(3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane has a molecular weight of 220.30 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-(difluoromethyl)-3,4-di(propan-2-yl)oxane is sourced from PubChem (CID 121421961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).