About cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one
cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one (PubChem CID 121421968) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one |
| PubChem CID | 121421968 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one |
| SMILES | CC(C)[C@H]1CCC(=O)C[C@H]1C(C)C |
| InChI | InChI=1S/C12H22O/c1-8(2)11-6-5-10(13)7-12(11)9(3)4/h8-9,11-12H,5-7H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | UIBHLNNPWRIMGQ-NEPJUHHUSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one?
The IUPAC name of cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one (CID 121421968) is cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one.
What is the SMILES notation for cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one?
The canonical SMILES for cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one is CC(C)[C@H]1CCC(=O)C[C@H]1C(C)C.
What is the InChIKey of cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one?
The InChIKey is UIBHLNNPWRIMGQ-NEPJUHHUSA-N. The full InChI is InChI=1S/C12H22O/c1-8(2)11-6-5-10(13)7-12(11)9(3)4/h8-9,11-12H,5-7H2,1-4H3/t11-,12+/m1/s1.
What are the key properties of cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one?
cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one has a molecular weight of 182.31 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3S,4R)-3,4-di(propan-2-yl)cyclohexan-1-one is sourced from PubChem (CID 121421968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).