C55H55N — CID 121422368
4-butyl-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-[4-[3-(4-ethenylphenyl)-1-adamantyl]phenyl]aniline (PubChem CID 121422368) has the molecular formula C55H55N and a molecular weight of 730.05 g/mol. Its IUPAC name is 4-butyl-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-[4-[3-(4-ethenylphenyl)-1-adamantyl]phenyl]aniline.
| Compound Name | 4-butyl-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-[4-[3-(4-ethenylphenyl)-1-adamantyl]phenyl]aniline |
|---|---|
| PubChem CID | 121422368 |
| Molecular Formula | C55H55N |
| Molecular Weight | 730.05 g/mol |
| Exact Mass | 729.43 |
| IUPAC Name | 4-butyl-N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-[4-[3-(4-ethenylphenyl)-1-adamantyl]phenyl]aniline |
| SMILES | C=Cc1ccc(C23CC4CC(C2)CC(c2ccc(N(c5ccc(CCCC)cc5)c5ccc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)cc5)cc2)(C4)C3)cc1 |
| InChI | InChI=1S/C55H55N/c1-5-7-10-39-15-24-46(25-16-39)56(47-26-17-42(18-27-47)43-19-30-50-49-11-8-9-12-51(49)53(3,4)52(50)32-43)48-28-22-45(23-29-48)55-35-40-31-41(36-55)34-54(33-40,37-55)44-20-13-38(6-2)14-21-44/h6,8-9,11-30,32,40-41H,2,5,7,10,31,33-37H2,1,3-4H3 |
| InChIKey | QRJLOVHEBTZXEW-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.05 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |