C38H44O7S — CID 121422663
4-[2,7-bis(2,5-dimethoxyphenyl)-9-pentylfluoren-9-yl]butane-1-sulfonic acid (PubChem CID 121422663) has the molecular formula C38H44O7S and a molecular weight of 644.83 g/mol. Its IUPAC name is 4-[2,7-bis(2,5-dimethoxyphenyl)-9-pentylfluoren-9-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2,7-bis(2,5-dimethoxyphenyl)-9-pentylfluoren-9-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 121422663 |
| Molecular Formula | C38H44O7S |
| Molecular Weight | 644.83 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 4-[2,7-bis(2,5-dimethoxyphenyl)-9-pentylfluoren-9-yl]butane-1-sulfonic acid |
| SMILES | CCCCCC1(CCCCS(=O)(=O)O)c2cc(-c3cc(OC)ccc3OC)ccc2-c2ccc(-c3cc(OC)ccc3OC)cc21 |
| InChI | InChI=1S/C38H44O7S/c1-6-7-8-19-38(20-9-10-21-46(39,40)41)34-22-26(32-24-28(42-2)13-17-36(32)44-4)11-15-30(34)31-16-12-27(23-35(31)38)33-25-29(43-3)14-18-37(33)45-5/h11-18,22-25H,6-10,19-21H2,1-5H3,(H,39,40,41) |
| InChIKey | IZCHVVNMMCPWEA-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.83 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|