C14H25BrN2 — CID 121422780
N-[(3E,5E)-6-bromo-3-ethylhexa-3,5-dienyl]-N-methylpiperidin-4-amine (PubChem CID 121422780) has the molecular formula C14H25BrN2 and a molecular weight of 301.27 g/mol. Its IUPAC name is N-[(3E,5E)-6-bromo-3-ethylhexa-3,5-dienyl]-N-methylpiperidin-4-amine.
| Compound Name | N-[(3E,5E)-6-bromo-3-ethylhexa-3,5-dienyl]-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 121422780 |
| Molecular Formula | C14H25BrN2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-[(3E,5E)-6-bromo-3-ethylhexa-3,5-dienyl]-N-methylpiperidin-4-amine |
| SMILES | CC/C(=C\C=C\Br)CCN(C)C1CCNCC1 |
| InChI | InChI=1S/C14H25BrN2/c1-3-13(5-4-9-15)8-12-17(2)14-6-10-16-11-7-14/h4-5,9,14,16H,3,6-8,10-12H2,1-2H3/b9-4+,13-5+ |
| InChIKey | CXVNPBRPGGDZHA-XNOVGRFCSA-N |
| XLogP | 3.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|