About [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate
[2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate (PubChem CID 121423028) has the molecular formula C20H38O4
and a molecular weight of 342.52 g/mol. Its IUPAC name is [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate |
| PubChem CID | 121423028 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C(O)(CC)CC)CC1C(O)(CC)CC |
| InChI | InChI=1S/C20H38O4/c1-7-14(6)18(21)24-17-13-15(19(22,8-2)9-3)12-16(17)20(23,10-4)11-5/h14-17,22-23H,7-13H2,1-6H3 |
| InChIKey | IXHDPDOPFPVIPV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate?
The IUPAC name of [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate (CID 121423028) is [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate.
What is the SMILES notation for [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate?
The canonical SMILES for [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate is CCC(C)C(=O)OC1CC(C(O)(CC)CC)CC1C(O)(CC)CC.
What is the InChIKey of [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate?
The InChIKey is IXHDPDOPFPVIPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O4/c1-7-14(6)18(21)24-17-13-15(19(22,8-2)9-3)12-16(17)20(23,10-4)11-5/h14-17,22-23H,7-13H2,1-6H3.
What are the key properties of [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate?
[2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate has a molecular weight of 342.52 g/mol, XLogP of 4.07, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(3-hydroxypentan-3-yl)cyclopentyl] 2-methylbutanoate is sourced from PubChem (CID 121423028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).