About [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate
[2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate (PubChem CID 121423055) has the molecular formula C19H32O7
and a molecular weight of 372.46 g/mol. Its IUPAC name is [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate |
| PubChem CID | 121423055 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(=O)OC1CC2OC1C(C(C)(C)O)C2C(C)(C)O |
| InChI | InChI=1S/C19H32O7/c1-7-10(2)17(21)24-9-13(20)25-12-8-11-14(18(3,4)22)15(16(12)26-11)19(5,6)23/h10-12,14-16,22-23H,7-9H2,1-6H3 |
| InChIKey | OUTHKEJAWOFDDX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate?
The IUPAC name of [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate (CID 121423055) is [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate.
What is the SMILES notation for [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate?
The canonical SMILES for [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate is CCC(C)C(=O)OCC(=O)OC1CC2OC1C(C(C)(C)O)C2C(C)(C)O.
What is the InChIKey of [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate?
The InChIKey is OUTHKEJAWOFDDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O7/c1-7-10(2)17(21)24-9-13(20)25-12-8-11-14(18(3,4)22)15(16(12)26-11)19(5,6)23/h10-12,14-16,22-23H,7-9H2,1-6H3.
What are the key properties of [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate?
[2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate has a molecular weight of 372.46 g/mol, XLogP of 1.43, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[5,6-bis(2-hydroxypropan-2-yl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-2-oxoethyl] 2-methylbutanoate is sourced from PubChem (CID 121423055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).