About cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol
cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol (PubChem CID 121423126) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol |
| PubChem CID | 121423126 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol |
| SMILES | CC(C)(O)[C@@H]1CC(O)C[C@H](C(C)(C)O)C1 |
| InChI | InChI=1S/C12H24O3/c1-11(2,14)8-5-9(12(3,4)15)7-10(13)6-8/h8-10,13-15H,5-7H2,1-4H3/t8-,9+,10? |
| InChIKey | VAVUUPIHCOHNGU-ULKQDVFKSA-N |
| XLogP | 1.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol?
The IUPAC name of cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol (CID 121423126) is cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol.
What is the SMILES notation for cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol?
The canonical SMILES for cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol is CC(C)(O)[C@@H]1CC(O)C[C@H](C(C)(C)O)C1.
What is the InChIKey of cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol?
The InChIKey is VAVUUPIHCOHNGU-ULKQDVFKSA-N. The full InChI is InChI=1S/C12H24O3/c1-11(2,14)8-5-9(12(3,4)15)7-10(13)6-8/h8-10,13-15H,5-7H2,1-4H3/t8-,9+,10?.
What are the key properties of cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol?
cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol has a molecular weight of 216.32 g/mol, XLogP of 1.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3R,5S)-3,5-bis(2-hydroxypropan-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 121423126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).