About 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine
3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine (PubChem CID 121424028) has the molecular formula C17H34N2O2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine |
| PubChem CID | 121424028 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine |
| SMILES | CCCCN1CCOC1CCCC1OCCN1CCCC |
| InChI | InChI=1S/C17H34N2O2/c1-3-5-10-18-12-14-20-16(18)8-7-9-17-19(11-6-4-2)13-15-21-17/h16-17H,3-15H2,1-2H3 |
| InChIKey | VARUTYJKNSICKT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine?
The IUPAC name of 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine (CID 121424028) is 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine.
What is the SMILES notation for 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine?
The canonical SMILES for 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine is CCCCN1CCOC1CCCC1OCCN1CCCC.
What is the InChIKey of 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine?
The InChIKey is VARUTYJKNSICKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O2/c1-3-5-10-18-12-14-20-16(18)8-7-9-17-19(11-6-4-2)13-15-21-17/h16-17H,3-15H2,1-2H3.
What are the key properties of 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine?
3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine has a molecular weight of 298.47 g/mol, XLogP of 3.07, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-[3-(3-butyl-1,3-oxazolidin-2-yl)propyl]-1,3-oxazolidine is sourced from PubChem (CID 121424028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).