C68H88N4O4S3 — CID 121425380
4-[5-[8-methyl-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-7-(5-methylthiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazole (PubChem CID 121425380) has the molecular formula C68H88N4O4S3 and a molecular weight of 1121.68 g/mol. Its IUPAC name is 4-[5-[8-methyl-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-7-(5-methylthiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[8-methyl-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-7-(5-methylthiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 121425380 |
| Molecular Formula | C68H88N4O4S3 |
| Molecular Weight | 1121.68 g/mol |
| Exact Mass | 1120.60 |
| IUPAC Name | 4-[5-[8-methyl-2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]thiophen-2-yl]-7-(5-methylthiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCOc1cccc(-c2nc3c(C)ccc(-c4ccc(-c5c(OCCCCCCCC)c(OCCCCCCCC)c(-c6ccc(C)s6)c6nsnc56)s4)c3nc2-c2cccc(OCCCCCCCC)c2)c1 |
| InChI | InChI=1S/C68H88N4O4S3/c1-7-11-15-19-23-27-43-73-53-35-31-33-51(47-53)62-63(52-34-32-36-54(48-52)74-44-28-24-20-16-12-8-2)70-64-55(39-37-49(5)61(64)69-62)56-41-42-58(78-56)60-66-65(71-79-72-66)59(57-40-38-50(6)77-57)67(75-45-29-25-21-17-13-9-3)68(60)76-46-30-26-22-18-14-10-4/h31-42,47-48H,7-30,43-46H2,1-6H3 |
| InChIKey | NXYCSDSDZRJUDA-UHFFFAOYSA-N |
| XLogP | 21.67 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.68 |
| LogP ≤ 5 | 21.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|