C19H19F3N2O2 — CID 121425488
[(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(2,4,5-trifluorophenyl)phenyl]carbamate (PubChem CID 121425488) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is [(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(2,4,5-trifluorophenyl)phenyl]carbamate.
| Compound Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(2,4,5-trifluorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 121425488 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(2,4,5-trifluorophenyl)phenyl]carbamate |
| SMILES | CN1CCC[C@H]1COC(=O)Nc1ccccc1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H19F3N2O2/c1-24-8-4-5-12(24)11-26-19(25)23-18-7-3-2-6-13(18)14-9-16(21)17(22)10-15(14)20/h2-3,6-7,9-10,12H,4-5,8,11H2,1H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | FVBUJFDEFSDKTJ-LBPRGKRZSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|