C19H18F4N2O2 — CID 121425500
[(2S)-1-methylpyrrolidin-2-yl]methyl N-[4-fluoro-2-(2,4,5-trifluorophenyl)phenyl]carbamate (PubChem CID 121425500) has the molecular formula C19H18F4N2O2 and a molecular weight of 382.36 g/mol. Its IUPAC name is [(2S)-1-methylpyrrolidin-2-yl]methyl N-[4-fluoro-2-(2,4,5-trifluorophenyl)phenyl]carbamate.
| Compound Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-[4-fluoro-2-(2,4,5-trifluorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 121425500 |
| Molecular Formula | C19H18F4N2O2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-[4-fluoro-2-(2,4,5-trifluorophenyl)phenyl]carbamate |
| SMILES | CN1CCC[C@H]1COC(=O)Nc1ccc(F)cc1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H18F4N2O2/c1-25-6-2-3-12(25)10-27-19(26)24-18-5-4-11(20)7-14(18)13-8-16(22)17(23)9-15(13)21/h4-5,7-9,12H,2-3,6,10H2,1H3,(H,24,26)/t12-/m0/s1 |
| InChIKey | RFMVVLNZPFVHKN-LBPRGKRZSA-N |
| XLogP | 4.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|