C23H29FN2O2 — CID 121425528
[(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(4-tert-butylphenyl)-4-fluorophenyl]carbamate (PubChem CID 121425528) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is [(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(4-tert-butylphenyl)-4-fluorophenyl]carbamate.
| Compound Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(4-tert-butylphenyl)-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 121425528 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-[2-(4-tert-butylphenyl)-4-fluorophenyl]carbamate |
| SMILES | CN1CCC[C@H]1COC(=O)Nc1ccc(F)cc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29FN2O2/c1-23(2,3)17-9-7-16(8-10-17)20-14-18(24)11-12-21(20)25-22(27)28-15-19-6-5-13-26(19)4/h7-12,14,19H,5-6,13,15H2,1-4H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | CIUBOWZZGJVPME-IBGZPJMESA-N |
| XLogP | 5.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |