C28H32F5N3O2 — CID 121425644
(2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol (PubChem CID 121425644) has the molecular formula C28H32F5N3O2 and a molecular weight of 537.57 g/mol. Its IUPAC name is (2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol.
| Compound Name | (2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 121425644 |
| Molecular Formula | C28H32F5N3O2 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | (2S)-3-[(1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccc(F)cc23)[C@@H](c2c(F)cc(OC3CN(CCCF)C3)cc2F)N1C[C@](C)(F)CO |
| InChI | InChI=1S/C28H32F5N3O2/c1-16-8-21-20-9-17(30)4-5-24(20)34-26(21)27(36(16)14-28(2,33)15-37)25-22(31)10-18(11-23(25)32)38-19-12-35(13-19)7-3-6-29/h4-5,9-11,16,19,27,34,37H,3,6-8,12-15H2,1-2H3/t16-,27-,28+/m1/s1 |
| InChIKey | QWYCMEGLFKJFGG-JOLLRLPSSA-N |
| XLogP | 5.06 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|