C28H34F4N4O2 — CID 121425648
(2R)-3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-hydroxypropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol (PubChem CID 121425648) has the molecular formula C28H34F4N4O2 and a molecular weight of 534.60 g/mol. Its IUPAC name is (2R)-3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-hydroxypropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol.
| Compound Name | (2R)-3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-hydroxypropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 121425648 |
| Molecular Formula | C28H34F4N4O2 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (2R)-3-[(1R,3R)-1-[2,6-difluoro-4-[[1-(3-hydroxypropyl)azetidin-3-yl]amino]phenyl]-7-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-fluoro-2-methylpropan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3cc(F)ccc23)[C@@H](c2c(F)cc(NC3CN(CCCO)C3)cc2F)N1C[C@@](C)(F)CO |
| InChI | InChI=1S/C28H34F4N4O2/c1-16-8-21-20-5-4-17(29)9-24(20)34-26(21)27(36(16)14-28(2,32)15-38)25-22(30)10-18(11-23(25)31)33-19-12-35(13-19)6-3-7-37/h4-5,9-11,16,19,27,33-34,37-38H,3,6-8,12-15H2,1-2H3/t16-,27-,28-/m1/s1 |
| InChIKey | ILFHEZIUFLVTLY-XBJZADGRSA-N |
| XLogP | 4.12 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|