C72H47N5S — CID 121425865
4,7-bis[4-(2,6-diphenyl-3-pyridinyl)phenyl]-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1,3-benzothiazole (PubChem CID 121425865) has the molecular formula C72H47N5S and a molecular weight of 1014.27 g/mol. Its IUPAC name is 4,7-bis[4-(2,6-diphenyl-3-pyridinyl)phenyl]-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 4,7-bis[4-(2,6-diphenyl-3-pyridinyl)phenyl]-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 121425865 |
| Molecular Formula | C72H47N5S |
| Molecular Weight | 1014.27 g/mol |
| Exact Mass | 1013.36 |
| IUPAC Name | 4,7-bis[4-(2,6-diphenyl-3-pyridinyl)phenyl]-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7ccccc7)nc6-c6ccccc6)cc5)c5sc(-c6ccc(-c7nc8ccccc8n7-c7ccccc7)cc6)nc45)cc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C72H47N5S/c1-6-18-52(19-7-1)63-46-44-59(67(73-63)54-22-10-3-11-23-54)48-30-32-50(33-31-48)61-42-43-62(51-36-34-49(35-37-51)60-45-47-64(53-20-8-2-9-21-53)74-68(60)55-24-12-4-13-25-55)70-69(61)76-72(78-70)57-40-38-56(39-41-57)71-75-65-28-16-17-29-66(65)77(71)58-26-14-5-15-27-58/h1-47H |
| InChIKey | AOFNWVBXXOITBH-UHFFFAOYSA-N |
| XLogP | 19.10 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.27 |
| LogP ≤ 5 | 19.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |