C21H26N6O4 — CID 121426182
1-[8-amino-3-[(2,3-dimethylphenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]-2-nitroethanol (PubChem CID 121426182) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is 1-[8-amino-3-[(2,3-dimethylphenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]-2-nitroethanol.
| Compound Name | 1-[8-amino-3-[(2,3-dimethylphenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]-2-nitroethanol |
|---|---|
| PubChem CID | 121426182 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-[8-amino-3-[(2,3-dimethylphenyl)methyl]-6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl]-2-nitroethanol |
| SMILES | Cc1cccc(Cc2c(C(O)C[N+](=O)[O-])nc3c(N)cc(N4CCOCC4)nn23)c1C |
| InChI | InChI=1S/C21H26N6O4/c1-13-4-3-5-15(14(13)2)10-17-20(18(28)12-26(29)30)23-21-16(22)11-19(24-27(17)21)25-6-8-31-9-7-25/h3-5,11,18,28H,6-10,12,22H2,1-2H3 |
| InChIKey | KPYZKFXXUOJFIY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|