C8H8Cl2N4O — CID 121426674
[(1R,2S)-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]cyclopropyl]methanimine (PubChem CID 121426674) has the molecular formula C8H8Cl2N4O and a molecular weight of 247.09 g/mol. Its IUPAC name is [(1R,2S)-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]cyclopropyl]methanimine.
| Compound Name | [(1R,2S)-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]cyclopropyl]methanimine |
|---|---|
| PubChem CID | 121426674 |
| Molecular Formula | C8H8Cl2N4O |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | [(1R,2S)-2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxymethyl]cyclopropyl]methanimine |
| SMILES | [H]/N=C/[C@@H]1C[C@@H]1COc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C8H8Cl2N4O/c9-6-12-7(10)14-8(13-6)15-3-5-1-4(5)2-11/h2,4-5,11H,1,3H2/b11-2+/t4-,5+/m0/s1 |
| InChIKey | LPPZARSRIHTWOA-JSZYGRFYSA-N |
| XLogP | 1.84 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|