C29H18F6O8S2 — CID 121426779
9-[4-(1,2,2,3,3,4-hexafluorocyclobutyl)oxyphenyl]-9-(4-hydroxyphenyl)fluorene-2,7-disulfonic acid (PubChem CID 121426779) has the molecular formula C29H18F6O8S2 and a molecular weight of 672.58 g/mol. Its IUPAC name is 9-[4-(1,2,2,3,3,4-hexafluorocyclobutyl)oxyphenyl]-9-(4-hydroxyphenyl)fluorene-2,7-disulfonic acid.
| Compound Name | 9-[4-(1,2,2,3,3,4-hexafluorocyclobutyl)oxyphenyl]-9-(4-hydroxyphenyl)fluorene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 121426779 |
| Molecular Formula | C29H18F6O8S2 |
| Molecular Weight | 672.58 g/mol |
| Exact Mass | 672.03 |
| IUPAC Name | 9-[4-(1,2,2,3,3,4-hexafluorocyclobutyl)oxyphenyl]-9-(4-hydroxyphenyl)fluorene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)C(c1ccc(O)cc1)(c1ccc(OC3(F)C(F)C(F)(F)C3(F)F)cc1)c1cc(S(=O)(=O)O)ccc1-2 |
| InChI | InChI=1S/C29H18F6O8S2/c30-25-27(31,32)29(34,35)28(25,33)43-18-7-3-16(4-8-18)26(15-1-5-17(36)6-2-15)23-13-19(44(37,38)39)9-11-21(23)22-12-10-20(14-24(22)26)45(40,41)42/h1-14,25,36H,(H,37,38,39)(H,40,41,42) |
| InChIKey | AZHLDLPNBNMUKE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|