C17H28O3 — CID 121426836
1-[(2S,3S)-2-[[(2R,4R,6S)-6-ethyl-4-methyl-3-methylideneoxan-2-yl]methyl]oxolan-3-yl]propan-2-one (PubChem CID 121426836) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-[(2S,3S)-2-[[(2R,4R,6S)-6-ethyl-4-methyl-3-methylideneoxan-2-yl]methyl]oxolan-3-yl]propan-2-one.
| Compound Name | 1-[(2S,3S)-2-[[(2R,4R,6S)-6-ethyl-4-methyl-3-methylideneoxan-2-yl]methyl]oxolan-3-yl]propan-2-one |
|---|---|
| PubChem CID | 121426836 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(2S,3S)-2-[[(2R,4R,6S)-6-ethyl-4-methyl-3-methylideneoxan-2-yl]methyl]oxolan-3-yl]propan-2-one |
| SMILES | C=C1[C@H](C)C[C@H](CC)O[C@@H]1C[C@@H]1OCC[C@H]1CC(C)=O |
| InChI | InChI=1S/C17H28O3/c1-5-15-8-11(2)13(4)16(20-15)10-17-14(6-7-19-17)9-12(3)18/h11,14-17H,4-10H2,1-3H3/t11-,14+,15+,16-,17+/m1/s1 |
| InChIKey | UHRMIEDVACXKNO-UTVHMOSLSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|