C33H38ClFN2O3 — CID 121426934
3-[3-[[2-[4-[5-(2-chloropropyl)-3-pyridinyl]-3-fluorophenyl]-2-cyclopentylacetyl]amino]-2-methylphenyl]pentanoic acid (PubChem CID 121426934) has the molecular formula C33H38ClFN2O3 and a molecular weight of 565.13 g/mol. Its IUPAC name is 3-[3-[[2-[4-[5-(2-chloropropyl)-3-pyridinyl]-3-fluorophenyl]-2-cyclopentylacetyl]amino]-2-methylphenyl]pentanoic acid.
| Compound Name | 3-[3-[[2-[4-[5-(2-chloropropyl)-3-pyridinyl]-3-fluorophenyl]-2-cyclopentylacetyl]amino]-2-methylphenyl]pentanoic acid |
|---|---|
| PubChem CID | 121426934 |
| Molecular Formula | C33H38ClFN2O3 |
| Molecular Weight | 565.13 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 3-[3-[[2-[4-[5-(2-chloropropyl)-3-pyridinyl]-3-fluorophenyl]-2-cyclopentylacetyl]amino]-2-methylphenyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1cccc(NC(=O)C(c2ccc(-c3cncc(CC(C)Cl)c3)c(F)c2)C2CCCC2)c1C |
| InChI | InChI=1S/C33H38ClFN2O3/c1-4-23(17-31(38)39)27-10-7-11-30(21(27)3)37-33(40)32(24-8-5-6-9-24)25-12-13-28(29(35)16-25)26-15-22(14-20(2)34)18-36-19-26/h7,10-13,15-16,18-20,23-24,32H,4-6,8-9,14,17H2,1-3H3,(H,37,40)(H,38,39) |
| InChIKey | YADMVWOGFIJIBT-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.13 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|