C24H28BrNO3 — CID 121426952
methyl 3-[3-[[2-(4-bromophenyl)-2-cyclobutylacetyl]amino]-2-methylphenyl]butanoate (PubChem CID 121426952) has the molecular formula C24H28BrNO3 and a molecular weight of 458.40 g/mol. Its IUPAC name is methyl 3-[3-[[2-(4-bromophenyl)-2-cyclobutylacetyl]amino]-2-methylphenyl]butanoate.
| Compound Name | methyl 3-[3-[[2-(4-bromophenyl)-2-cyclobutylacetyl]amino]-2-methylphenyl]butanoate |
|---|---|
| PubChem CID | 121426952 |
| Molecular Formula | C24H28BrNO3 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | methyl 3-[3-[[2-(4-bromophenyl)-2-cyclobutylacetyl]amino]-2-methylphenyl]butanoate |
| SMILES | COC(=O)CC(C)c1cccc(NC(=O)C(c2ccc(Br)cc2)C2CCC2)c1C |
| InChI | InChI=1S/C24H28BrNO3/c1-15(14-22(27)29-3)20-8-5-9-21(16(20)2)26-24(28)23(17-6-4-7-17)18-10-12-19(25)13-11-18/h5,8-13,15,17,23H,4,6-7,14H2,1-3H3,(H,26,28) |
| InChIKey | RSHIISSSYXWKGG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |