About 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene
4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene (PubChem CID 121427411) has the molecular formula C11H14F2OS
and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene |
| PubChem CID | 121427411 |
| Molecular Formula | C11H14F2OS |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene |
| SMILES | CCOC(C)CSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14F2OS/c1-3-14-8(2)7-15-9-4-5-10(12)11(13)6-9/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | IUAVHZXYDSAHCL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene?
The IUPAC name of 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene (CID 121427411) is 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene.
What is the SMILES notation for 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene?
The canonical SMILES for 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene is CCOC(C)CSc1ccc(F)c(F)c1.
What is the InChIKey of 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene?
The InChIKey is IUAVHZXYDSAHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2OS/c1-3-14-8(2)7-15-9-4-5-10(12)11(13)6-9/h4-6,8H,3,7H2,1-2H3.
What are the key properties of 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene?
4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene has a molecular weight of 232.29 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethoxypropylsulfanyl)-1,2-difluorobenzene is sourced from PubChem (CID 121427411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).