6,7-dihydro-1,3-benzothiazole-2-carboxylic acid

C8H7NO2S — CID 121427437

IUPAC6,7-dihydro-1,3-benzothiazole-2-carboxylic acid
SMILESO=C(O)c1nc2c(s1)CCC=C2
InChIInChI=1S/C8H7NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1,3H,2,4H2,(H,10,11)
InChIKeyQLECBGSDKRGIFU-UHFFFAOYSA-N
MW181.22 g/mol
LogP1.80
Rot. Bonds1

About 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid

6,7-dihydro-1,3-benzothiazole-2-carboxylic acid (PubChem CID 121427437) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid.

Molecular Properties

Compound Name6,7-dihydro-1,3-benzothiazole-2-carboxylic acid
PubChem CID121427437
Molecular FormulaC8H7NO2S
Molecular Weight181.22 g/mol
Exact Mass181.02
IUPAC Name6,7-dihydro-1,3-benzothiazole-2-carboxylic acid
SMILESO=C(O)c1nc2c(s1)CCC=C2
InChIInChI=1S/C8H7NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1,3H,2,4H2,(H,10,11)
InChIKeyQLECBGSDKRGIFU-UHFFFAOYSA-N
XLogP1.80
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.22
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
The IUPAC name of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid (CID 121427437) is 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid.
What is the SMILES notation for 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
The canonical SMILES for 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid is O=C(O)c1nc2c(s1)CCC=C2.
What is the InChIKey of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
The InChIKey is QLECBGSDKRGIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1,3H,2,4H2,(H,10,11).
What are the key properties of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
6,7-dihydro-1,3-benzothiazole-2-carboxylic acid has a molecular weight of 181.22 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid is sourced from PubChem (CID 121427437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).