About 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid
6,7-dihydro-1,3-benzothiazole-2-carboxylic acid (PubChem CID 121427437) has the molecular formula C8H7NO2S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid |
| PubChem CID | 121427437 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc2c(s1)CCC=C2 |
| InChI | InChI=1S/C8H7NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1,3H,2,4H2,(H,10,11) |
| InChIKey | QLECBGSDKRGIFU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
The IUPAC name of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid (CID 121427437) is 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid.
What is the SMILES notation for 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
The canonical SMILES for 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid is O=C(O)c1nc2c(s1)CCC=C2.
What is the InChIKey of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
The InChIKey is QLECBGSDKRGIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1,3H,2,4H2,(H,10,11).
What are the key properties of 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid?
6,7-dihydro-1,3-benzothiazole-2-carboxylic acid has a molecular weight of 181.22 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-1,3-benzothiazole-2-carboxylic acid is sourced from PubChem (CID 121427437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).