C20H23N5O2 — CID 121427761
2-[3-[(4-imino-2,3,7-trimethyl-3a,7a-dihydro-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxyethanol (PubChem CID 121427761) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[3-[(4-imino-2,3,7-trimethyl-3a,7a-dihydro-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxyethanol.
| Compound Name | 2-[3-[(4-imino-2,3,7-trimethyl-3a,7a-dihydro-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxyethanol |
|---|---|
| PubChem CID | 121427761 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[3-[(4-imino-2,3,7-trimethyl-3a,7a-dihydro-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]oxyethanol |
| SMILES | [H]/N=C1C(=N\c2c(OCCO)nn3ccccc23)\C=C(C)C2NC(C)=C(C)C\12 |
| InChI | InChI=1S/C20H23N5O2/c1-11-10-14(17(21)16-12(2)13(3)22-18(11)16)23-19-15-6-4-5-7-25(15)24-20(19)27-9-8-26/h4-7,10,16,18,21-22,26H,8-9H2,1-3H3/b21-17+,23-14+ |
| InChIKey | ZRKLQEXIICAXIR-RRZUHXDGSA-N |
| XLogP | 2.64 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|