C10H7N3O2S — CID 121427855
9-hydroxy-1,10-dihydropyrimido[5,4-b][1,4]benzoxazine-2-thione (PubChem CID 121427855) has the molecular formula C10H7N3O2S and a molecular weight of 233.25 g/mol. Its IUPAC name is 9-hydroxy-1,10-dihydropyrimido[5,4-b][1,4]benzoxazine-2-thione.
| Compound Name | 9-hydroxy-1,10-dihydropyrimido[5,4-b][1,4]benzoxazine-2-thione |
|---|---|
| PubChem CID | 121427855 |
| Molecular Formula | C10H7N3O2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 9-hydroxy-1,10-dihydropyrimido[5,4-b][1,4]benzoxazine-2-thione |
| SMILES | Oc1cccc2c1Nc1[nH]c(=S)ncc1O2 |
| InChI | InChI=1S/C10H7N3O2S/c14-5-2-1-3-6-8(5)12-9-7(15-6)4-11-10(16)13-9/h1-4,14H,(H2,11,12,13,16) |
| InChIKey | QBWJXZFVBHSKMP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|