C21H25N5O3 — CID 121428533
(5S,6S)-13-ethyl-6-(hydroxymethyl)-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one (PubChem CID 121428533) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (5S,6S)-13-ethyl-6-(hydroxymethyl)-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one.
| Compound Name | (5S,6S)-13-ethyl-6-(hydroxymethyl)-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
|---|---|
| PubChem CID | 121428533 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (5S,6S)-13-ethyl-6-(hydroxymethyl)-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
| SMILES | CCn1ncc2cc3nc(c21)CCCO[C@H](CO)[C@H](c1ccccc1)NC(=O)N3 |
| InChI | InChI=1S/C21H25N5O3/c1-2-26-20-15(12-22-26)11-18-23-16(20)9-6-10-29-17(13-27)19(25-21(28)24-18)14-7-4-3-5-8-14/h3-5,7-8,11-12,17,19,27H,2,6,9-10,13H2,1H3,(H2,23,24,25,28)/t17-,19+/m1/s1 |
| InChIKey | ILQXAAGAKNRVJZ-MJGOQNOKSA-N |
| XLogP | 2.64 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |