C22H27N5O3 — CID 121428535
(5R,6R)-13-ethyl-6-[(1R)-1-hydroxyethyl]-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one (PubChem CID 121428535) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (5R,6R)-13-ethyl-6-[(1R)-1-hydroxyethyl]-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one.
| Compound Name | (5R,6R)-13-ethyl-6-[(1R)-1-hydroxyethyl]-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
|---|---|
| PubChem CID | 121428535 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (5R,6R)-13-ethyl-6-[(1R)-1-hydroxyethyl]-5-phenyl-7-oxa-2,4,13,14,18-pentazatricyclo[9.6.1.012,16]octadeca-1(18),11,14,16-tetraen-3-one |
| SMILES | CCn1ncc2cc3nc(c21)CCCO[C@@H]([C@@H](C)O)[C@@H](c1ccccc1)NC(=O)N3 |
| InChI | InChI=1S/C22H27N5O3/c1-3-27-20-16(13-23-27)12-18-24-17(20)10-7-11-30-21(14(2)28)19(26-22(29)25-18)15-8-5-4-6-9-15/h4-6,8-9,12-14,19,21,28H,3,7,10-11H2,1-2H3,(H2,24,25,26,29)/t14-,19-,21+/m1/s1 |
| InChIKey | ZOCDMCKSAQKHPE-MMACOIQUSA-N |
| XLogP | 3.03 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |