C23H24FN6O6PS — CID 121429089
N-[9-[(3R,4R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphinothioyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 121429089) has the molecular formula C23H24FN6O6PS and a molecular weight of 562.52 g/mol. Its IUPAC name is N-[9-[(3R,4R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphinothioyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3R,4R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphinothioyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 121429089 |
| Molecular Formula | C23H24FN6O6PS |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | N-[9-[(3R,4R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphinothioyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | C=CCOP(=S)(OCCC#N)O[C@@H]1C(CO)OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H]1F |
| InChI | InChI=1S/C23H24FN6O6PS/c1-2-10-33-37(38,34-11-6-9-25)36-19-16(12-31)35-23(17(19)24)30-14-28-18-20(26-13-27-21(18)30)29-22(32)15-7-4-3-5-8-15/h2-5,7-8,13-14,16-17,19,23,31H,1,6,10-12H2,(H,26,27,29,32)/t16?,17-,19-,23?,37?/m1/s1 |
| InChIKey | SKWMZTRAVZVLOD-VUVIYGPCSA-N |
| XLogP | 3.05 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|