C11H14N5O13P3 — CID 121429321
[[(2R,3S)-5-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-2-ethynyl-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 121429321) has the molecular formula C11H14N5O13P3 and a molecular weight of 517.18 g/mol. Its IUPAC name is [[(2R,3S)-5-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-2-ethynyl-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S)-5-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-2-ethynyl-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 121429321 |
| Molecular Formula | C11H14N5O13P3 |
| Molecular Weight | 517.18 g/mol |
| Exact Mass | 516.98 |
| IUPAC Name | [[(2R,3S)-5-[4-(aminodiazenyl)-2-oxopyrimidin-1-yl]-2-ethynyl-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(n2ccc(/N=N/N)nc2=O)=C[C@@H]1O |
| InChI | InChI=1S/C11H14N5O13P3/c1-2-11(6-26-31(22,23)29-32(24,25)28-30(19,20)21)7(17)5-9(27-11)16-4-3-8(14-15-12)13-10(16)18/h1,3-5,7,17H,6H2,(H,22,23)(H,24,25)(H2,19,20,21)(H2,12,13,14,18)/t7-,11+/m0/s1 |
| InChIKey | ZLVKMKFAZQGZMS-WRWORJQWSA-N |
| XLogP | -0.89 |
| TPSA | 274.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.18 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|