About 4,4a,5,6-tetrahydroquinoline
4,4a,5,6-tetrahydroquinoline (PubChem CID 121429499) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 4,4a,5,6-tetrahydroquinoline.
Molecular Properties
| Compound Name | 4,4a,5,6-tetrahydroquinoline |
| PubChem CID | 121429499 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4,4a,5,6-tetrahydroquinoline |
| SMILES | C1=CC2=NC=CCC2CC1 |
| InChI | InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h2-3,6-8H,1,4-5H2 |
| InChIKey | KOYMXZNQQKWCKC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4a,5,6-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4a,5,6-tetrahydroquinoline?
The IUPAC name of 4,4a,5,6-tetrahydroquinoline (CID 121429499) is 4,4a,5,6-tetrahydroquinoline.
What is the SMILES notation for 4,4a,5,6-tetrahydroquinoline?
The canonical SMILES for 4,4a,5,6-tetrahydroquinoline is C1=CC2=NC=CCC2CC1.
What is the InChIKey of 4,4a,5,6-tetrahydroquinoline?
The InChIKey is KOYMXZNQQKWCKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h2-3,6-8H,1,4-5H2.
What are the key properties of 4,4a,5,6-tetrahydroquinoline?
4,4a,5,6-tetrahydroquinoline has a molecular weight of 133.19 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4a,5,6-tetrahydroquinoline is sourced from PubChem (CID 121429499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).