About 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine
4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine (PubChem CID 121429670) has the molecular formula C9H6F3N3O2
and a molecular weight of 245.16 g/mol. Its IUPAC name is 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine |
| PubChem CID | 121429670 |
| Molecular Formula | C9H6F3N3O2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C9H6F3N3O2/c10-9(11,12)16-6-4-2-1-3-5(6)7-8(13)15-17-14-7/h1-4H,(H2,13,15) |
| InChIKey | YCLPRJUVYKHZCT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine?
The IUPAC name of 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine (CID 121429670) is 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine.
What is the SMILES notation for 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine?
The canonical SMILES for 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine is Nc1nonc1-c1ccccc1OC(F)(F)F.
What is the InChIKey of 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine?
The InChIKey is YCLPRJUVYKHZCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N3O2/c10-9(11,12)16-6-4-2-1-3-5(6)7-8(13)15-17-14-7/h1-4H,(H2,13,15).
What are the key properties of 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine?
4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine has a molecular weight of 245.16 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-3-amine is sourced from PubChem (CID 121429670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).