C24H25F2N7OS — CID 121429980
(3,3-difluoropyrrolidin-1-yl)-[(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 121429980) has the molecular formula C24H25F2N7OS and a molecular weight of 497.58 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 121429980 |
| Molecular Formula | C24H25F2N7OS |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[(7S)-4-[[6-(dimethylamino)pyrazolo[1,5-a]pyridin-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | CN(C)c1cn2nccc2cc1Nc1ncnc2sc3c(c12)CC[C@H](C(=O)N1CCC(F)(F)C1)C3 |
| InChI | InChI=1S/C24H25F2N7OS/c1-31(2)18-11-33-15(5-7-29-33)10-17(18)30-21-20-16-4-3-14(9-19(16)35-22(20)28-13-27-21)23(34)32-8-6-24(25,26)12-32/h5,7,10-11,13-14H,3-4,6,8-9,12H2,1-2H3,(H,27,28,30)/t14-/m0/s1 |
| InChIKey | MPVORZJMCGGFNQ-AWEZNQCLSA-N |
| XLogP | 4.12 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |