C13H22F2O3 — CID 121430272
(2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-1,1-difluorobutan-2-ol (PubChem CID 121430272) has the molecular formula C13H22F2O3 and a molecular weight of 264.31 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-1,1-difluorobutan-2-ol.
| Compound Name | (2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-1,1-difluorobutan-2-ol |
|---|---|
| PubChem CID | 121430272 |
| Molecular Formula | C13H22F2O3 |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R)-2-[(4S,5S)-2,2-dimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]-1,1-difluorobutan-2-ol |
| SMILES | CC[C@](O)(C(F)F)[C@H]1OC(C)(C)O[C@H]1C=C(C)C |
| InChI | InChI=1S/C13H22F2O3/c1-6-13(16,11(14)15)10-9(7-8(2)3)17-12(4,5)18-10/h7,9-11,16H,6H2,1-5H3/t9-,10-,13+/m0/s1 |
| InChIKey | MKXIGAIHXDTQFQ-OUJBWJOFSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|