C13H22O6 — CID 121430412
(3S,5R)-4-[[(3R)-3-hydroxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]oxy]-2,6-dimethyloxane-3,5-diol (PubChem CID 121430412) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (3S,5R)-4-[[(3R)-3-hydroxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]oxy]-2,6-dimethyloxane-3,5-diol.
| Compound Name | (3S,5R)-4-[[(3R)-3-hydroxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]oxy]-2,6-dimethyloxane-3,5-diol |
|---|---|
| PubChem CID | 121430412 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (3S,5R)-4-[[(3R)-3-hydroxy-2-methyl-3,6-dihydro-2H-pyran-6-yl]oxy]-2,6-dimethyloxane-3,5-diol |
| SMILES | CC1OC(C)[C@H](O)C(OC2C=C[C@@H](O)C(C)O2)[C@@H]1O |
| InChI | InChI=1S/C13H22O6/c1-6-9(14)4-5-10(18-6)19-13-11(15)7(2)17-8(3)12(13)16/h4-16H,1-3H3/t6?,7?,8?,9-,10?,11-,12+,13?/m1/s1 |
| InChIKey | NZQJOMFYFPYMNO-YNZQIPLNSA-N |
| XLogP | -0.44 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|