C14H18N+ — CID 121431909
5-methyl-6-methylidene-1-azoniatricyclo[6.4.1.04,13]trideca-1(13),4,7-triene (PubChem CID 121431909) has the molecular formula C14H18N+ and a molecular weight of 200.30 g/mol. Its IUPAC name is 5-methyl-6-methylidene-1-azoniatricyclo[6.4.1.04,13]trideca-1(13),4,7-triene.
| Compound Name | 5-methyl-6-methylidene-1-azoniatricyclo[6.4.1.04,13]trideca-1(13),4,7-triene |
|---|---|
| PubChem CID | 121431909 |
| Molecular Formula | C14H18N+ |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 5-methyl-6-methylidene-1-azoniatricyclo[6.4.1.04,13]trideca-1(13),4,7-triene |
| SMILES | C=c1cc2c3c(c1C)CC[N+]=3CCCC2 |
| InChI | InChI=1S/C14H18N/c1-10-9-12-5-3-4-7-15-8-6-13(11(10)2)14(12)15/h9H,1,3-8H2,2H3/q+1 |
| InChIKey | ZSLBHLJEPJIBDQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|