C30H46O8 — CID 121432013
3-[(10S,13S)-9,18-dihydroxy-17-(4-hydroxybutan-2-yloxy)-1,5,18-trimethyl-16,19-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-6-yl]-2H-furan-5-one (PubChem CID 121432013) has the molecular formula C30H46O8 and a molecular weight of 534.69 g/mol. Its IUPAC name is 3-[(10S,13S)-9,18-dihydroxy-17-(4-hydroxybutan-2-yloxy)-1,5,18-trimethyl-16,19-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-6-yl]-2H-furan-5-one.
| Compound Name | 3-[(10S,13S)-9,18-dihydroxy-17-(4-hydroxybutan-2-yloxy)-1,5,18-trimethyl-16,19-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-6-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 121432013 |
| Molecular Formula | C30H46O8 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 3-[(10S,13S)-9,18-dihydroxy-17-(4-hydroxybutan-2-yloxy)-1,5,18-trimethyl-16,19-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-6-yl]-2H-furan-5-one |
| SMILES | CC(CCO)OC1OC2C[C@@H]3CC[C@H]4C(CCC5(C)C(C6=CC(=O)OC6)CCC45O)C3(C)CC2OC1(C)O |
| InChI | InChI=1S/C30H46O8/c1-17(9-12-31)36-26-29(4,33)38-24-15-27(2)19(14-23(24)37-26)5-6-22-21(27)7-10-28(3)20(8-11-30(22,28)34)18-13-25(32)35-16-18/h13,17,19-24,26,31,33-34H,5-12,14-16H2,1-4H3/t17?,19-,20?,21?,22-,23?,24?,26?,27?,28?,29?,30?/m0/s1 |
| InChIKey | UTMBJAWLFASVMP-LMKNFGLESA-N |
| XLogP | 3.46 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |