C23H35N3O — CID 121432154
3-[(1R,5S)-8-[2-(cyclohexylmethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 121432154) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is 3-[(1R,5S)-8-[2-(cyclohexylmethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 3-[(1R,5S)-8-[2-(cyclohexylmethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 121432154 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | 3-[(1R,5S)-8-[2-(cyclohexylmethylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | NC(=O)c1cccc(C2C[C@H]3CC[C@@H](C2)N3CCNCC2CCCCC2)c1 |
| InChI | InChI=1S/C23H35N3O/c24-23(27)19-8-4-7-18(13-19)20-14-21-9-10-22(15-20)26(21)12-11-25-16-17-5-2-1-3-6-17/h4,7-8,13,17,20-22,25H,1-3,5-6,9-12,14-16H2,(H2,24,27)/t20?,21-,22+ |
| InChIKey | RWFLDXRPMXAIED-FRIKZZABSA-N |
| XLogP | 3.67 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|