About 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one
5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one (PubChem CID 121432219) has the molecular formula C16H15NO3S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one.
Molecular Properties
| Compound Name | 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one |
| PubChem CID | 121432219 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one |
| SMILES | CCN1C(=O)c2ccccc2S(=O)(=O)c2ccc(C)cc21 |
| InChI | InChI=1S/C16H15NO3S/c1-3-17-13-10-11(2)8-9-15(13)21(19,20)14-7-5-4-6-12(14)16(17)18/h4-10H,3H2,1-2H3 |
| InChIKey | YRULMFDODMSGAF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one?
The IUPAC name of 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one (CID 121432219) is 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one.
What is the SMILES notation for 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one?
The canonical SMILES for 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one is CCN1C(=O)c2ccccc2S(=O)(=O)c2ccc(C)cc21.
What is the InChIKey of 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one?
The InChIKey is YRULMFDODMSGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3S/c1-3-17-13-10-11(2)8-9-15(13)21(19,20)14-7-5-4-6-12(14)16(17)18/h4-10H,3H2,1-2H3.
What are the key properties of 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one?
5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one has a molecular weight of 301.37 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-methyl-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one is sourced from PubChem (CID 121432219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).