C22H25F2N3O2S — CID 121432513
methyl 2-diazenyl-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]propanoate (PubChem CID 121432513) has the molecular formula C22H25F2N3O2S and a molecular weight of 433.52 g/mol. Its IUPAC name is methyl 2-diazenyl-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]propanoate.
| Compound Name | methyl 2-diazenyl-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 121432513 |
| Molecular Formula | C22H25F2N3O2S |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl 2-diazenyl-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-6-phenylthiazinan-2-yl]methyl]phenyl]propanoate |
| SMILES | [H]/N=N/C(C)(C(=O)OC)c1cc(F)c(CN2S[C@@H](c3ccccc3)CC[C@@H]2C)cc1F |
| InChI | InChI=1S/C22H25F2N3O2S/c1-14-9-10-20(15-7-5-4-6-8-15)30-27(14)13-16-11-19(24)17(12-18(16)23)22(2,26-25)21(28)29-3/h4-8,11-12,14,20,25H,9-10,13H2,1-3H3/b26-25+/t14-,20+,22?/m0/s1 |
| InChIKey | GYLYBWFGSZFLKG-BWCXUNCRSA-N |
| XLogP | 5.76 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|