3-amino-1,2,4-triazole-4-carboxylic acid

C3H4N4O2 — CID 121433460

IUPAC3-amino-1,2,4-triazole-4-carboxylic acid
SMILESNc1nncn1C(=O)O
InChIInChI=1S/C3H4N4O2/c4-2-6-5-1-7(2)3(8)9/h1H,(H2,4,6)(H,8,9)
InChIKeyBOMFYGQPRLXWIF-UHFFFAOYSA-N
MW128.09 g/mol
LogP-0.61
Rot. Bonds

About 3-amino-1,2,4-triazole-4-carboxylic acid

3-amino-1,2,4-triazole-4-carboxylic acid (PubChem CID 121433460) has the molecular formula C3H4N4O2 and a molecular weight of 128.09 g/mol. Its IUPAC name is 3-amino-1,2,4-triazole-4-carboxylic acid.

Molecular Properties

Compound Name3-amino-1,2,4-triazole-4-carboxylic acid
PubChem CID121433460
Molecular FormulaC3H4N4O2
Molecular Weight128.09 g/mol
Exact Mass128.03
IUPAC Name3-amino-1,2,4-triazole-4-carboxylic acid
SMILESNc1nncn1C(=O)O
InChIInChI=1S/C3H4N4O2/c4-2-6-5-1-7(2)3(8)9/h1H,(H2,4,6)(H,8,9)
InChIKeyBOMFYGQPRLXWIF-UHFFFAOYSA-N
XLogP-0.61
TPSA94.03 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.09
LogP ≤ 5-0.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-amino-1,2,4-triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-1,2,4-triazole-4-carboxylic acid?
The IUPAC name of 3-amino-1,2,4-triazole-4-carboxylic acid (CID 121433460) is 3-amino-1,2,4-triazole-4-carboxylic acid.
What is the SMILES notation for 3-amino-1,2,4-triazole-4-carboxylic acid?
The canonical SMILES for 3-amino-1,2,4-triazole-4-carboxylic acid is Nc1nncn1C(=O)O.
What is the InChIKey of 3-amino-1,2,4-triazole-4-carboxylic acid?
The InChIKey is BOMFYGQPRLXWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4O2/c4-2-6-5-1-7(2)3(8)9/h1H,(H2,4,6)(H,8,9).
What are the key properties of 3-amino-1,2,4-triazole-4-carboxylic acid?
3-amino-1,2,4-triazole-4-carboxylic acid has a molecular weight of 128.09 g/mol, XLogP of -0.61, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,2,4-triazole-4-carboxylic acid is sourced from PubChem (CID 121433460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).