C13H11FN2O — CID 121434034
3-[2-(3-fluorophenyl)ethynyl]-4,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,2]oxazole (PubChem CID 121434034) has the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethynyl]-4,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,2]oxazole.
| Compound Name | 3-[2-(3-fluorophenyl)ethynyl]-4,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,2]oxazole |
|---|---|
| PubChem CID | 121434034 |
| Molecular Formula | C13H11FN2O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethynyl]-4,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,2]oxazole |
| SMILES | Fc1cccc(C#CC2=C3CCNC3ON2)c1 |
| InChI | InChI=1S/C13H11FN2O/c14-10-3-1-2-9(8-10)4-5-12-11-6-7-15-13(11)17-16-12/h1-3,8,13,15-16H,6-7H2 |
| InChIKey | ICXMNZURKJPNEH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|