C19H17ClN4O2 — CID 121434121
[3-[2-(3-chlorophenyl)ethynyl]-3a,4,5,6a-tetrahydropyrrolo[3,2-d][1,2]oxazol-6-yl]-(1,5-dimethylpyrazol-3-yl)methanone (PubChem CID 121434121) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is [3-[2-(3-chlorophenyl)ethynyl]-3a,4,5,6a-tetrahydropyrrolo[3,2-d][1,2]oxazol-6-yl]-(1,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | [3-[2-(3-chlorophenyl)ethynyl]-3a,4,5,6a-tetrahydropyrrolo[3,2-d][1,2]oxazol-6-yl]-(1,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 121434121 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [3-[2-(3-chlorophenyl)ethynyl]-3a,4,5,6a-tetrahydropyrrolo[3,2-d][1,2]oxazol-6-yl]-(1,5-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC3C(C#Cc4cccc(Cl)c4)=NOC32)nn1C |
| InChI | InChI=1S/C19H17ClN4O2/c1-12-10-17(21-23(12)2)18(25)24-9-8-15-16(22-26-19(15)24)7-6-13-4-3-5-14(20)11-13/h3-5,10-11,15,19H,8-9H2,1-2H3 |
| InChIKey | WWOSHKWYCKHFHU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|