C9H11NO3 — CID 121434378
4,5-dihydroxy-4,5,6,7-tetrahydro-1H-indole-3-carbaldehyde (PubChem CID 121434378) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4,5-dihydroxy-4,5,6,7-tetrahydro-1H-indole-3-carbaldehyde.
| Compound Name | 4,5-dihydroxy-4,5,6,7-tetrahydro-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 121434378 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4,5-dihydroxy-4,5,6,7-tetrahydro-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c[nH]c2c1C(O)C(O)CC2 |
| InChI | InChI=1S/C9H11NO3/c11-4-5-3-10-6-1-2-7(12)9(13)8(5)6/h3-4,7,9-10,12-13H,1-2H2 |
| InChIKey | YNDXFJIBSKNJPU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|