About 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid
5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid (PubChem CID 121434449) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid |
| PubChem CID | 121434449 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid |
| SMILES | [H]/N=C1\C=NC(C(=O)O)CC1 |
| InChI | InChI=1S/C6H8N2O2/c7-4-1-2-5(6(9)10)8-3-4/h3,5,7H,1-2H2,(H,9,10)/b7-4- |
| InChIKey | GGGZOULAEIUBJN-DAXSKMNVSA-N |
| XLogP | 0.32 |
| TPSA | 73.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid?
The IUPAC name of 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid (CID 121434449) is 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid.
What is the SMILES notation for 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid?
The canonical SMILES for 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid is [H]/N=C1\C=NC(C(=O)O)CC1.
What is the InChIKey of 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid?
The InChIKey is GGGZOULAEIUBJN-DAXSKMNVSA-N. The full InChI is InChI=1S/C6H8N2O2/c7-4-1-2-5(6(9)10)8-3-4/h3,5,7H,1-2H2,(H,9,10)/b7-4-.
What are the key properties of 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid?
5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid has a molecular weight of 140.14 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-3,4-dihydro-2H-pyridine-2-carboxylic acid is sourced from PubChem (CID 121434449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).