C29H35N7O3 — CID 121434831
ethyl 4-[2-[4-(2,8-diazaspiro[4.5]decane-2-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 121434831) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is ethyl 4-[2-[4-(2,8-diazaspiro[4.5]decane-2-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(2,8-diazaspiro[4.5]decane-2-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 121434831 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | ethyl 4-[2-[4-(2,8-diazaspiro[4.5]decane-2-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CC=C(c2cccn3nc(Nc4ccc(C(=O)N5CCC6(CCNCC6)C5)cc4)nc23)CC1 |
| InChI | InChI=1S/C29H35N7O3/c1-2-39-28(38)34-17-9-21(10-18-34)24-4-3-16-36-25(24)32-27(33-36)31-23-7-5-22(6-8-23)26(37)35-19-13-29(20-35)11-14-30-15-12-29/h3-9,16,30H,2,10-15,17-20H2,1H3,(H,31,33) |
| InChIKey | ZNCXGRUNQJRNNB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |