C18H15ClFN5O — CID 121435101
N-(3-chlorophenyl)-3-(2-fluoro-3-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 121435101) has the molecular formula C18H15ClFN5O and a molecular weight of 371.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(2-fluoro-3-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-(2-fluoro-3-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 121435101 |
| Molecular Formula | C18H15ClFN5O |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-(3-chlorophenyl)-3-(2-fluoro-3-pyridinyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCc2[nH]nc(-c3cccnc3F)c2C1 |
| InChI | InChI=1S/C18H15ClFN5O/c19-11-3-1-4-12(9-11)22-18(26)25-8-6-15-14(10-25)16(24-23-15)13-5-2-7-21-17(13)20/h1-5,7,9H,6,8,10H2,(H,22,26)(H,23,24) |
| InChIKey | RVJAPVBHCLBTHZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|