C18H22ClN5O3 — CID 121437183
5-N-(3-chlorophenyl)-3-N-methoxy-3-N-propan-2-yl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide (PubChem CID 121437183) has the molecular formula C18H22ClN5O3 and a molecular weight of 391.86 g/mol. Its IUPAC name is 5-N-(3-chlorophenyl)-3-N-methoxy-3-N-propan-2-yl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(3-chlorophenyl)-3-N-methoxy-3-N-propan-2-yl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 121437183 |
| Molecular Formula | C18H22ClN5O3 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 5-N-(3-chlorophenyl)-3-N-methoxy-3-N-propan-2-yl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
| SMILES | CON(C(=O)c1n[nH]c2c1CN(C(=O)Nc1cccc(Cl)c1)CC2)C(C)C |
| InChI | InChI=1S/C18H22ClN5O3/c1-11(2)24(27-3)17(25)16-14-10-23(8-7-15(14)21-22-16)18(26)20-13-6-4-5-12(19)9-13/h4-6,9,11H,7-8,10H2,1-3H3,(H,20,26)(H,21,22) |
| InChIKey | PQQPEAPWNBGNFG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|