C18H14F12O9S — CID 121437187
3,5-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]benzenesulfonic acid (PubChem CID 121437187) has the molecular formula C18H14F12O9S and a molecular weight of 634.34 g/mol. Its IUPAC name is 3,5-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]benzenesulfonic acid.
| Compound Name | 3,5-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 121437187 |
| Molecular Formula | C18H14F12O9S |
| Molecular Weight | 634.34 g/mol |
| Exact Mass | 634.02 |
| IUPAC Name | 3,5-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]benzenesulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1cc(C(=O)OCCC(O)(C(F)(F)F)C(F)(F)F)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H14F12O9S/c19-15(20,21)13(33,16(22,23)24)1-3-38-11(31)8-5-9(7-10(6-8)40(35,36)37)12(32)39-4-2-14(34,17(25,26)27)18(28,29)30/h5-7,33-34H,1-4H2,(H,35,36,37) |
| InChIKey | UXYQHVQMIACIAF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|