C10H18N2 — CID 121437323
3-piperidin-4-yl-1,2,3,4-tetrahydropyridine (PubChem CID 121437323) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-piperidin-4-yl-1,2,3,4-tetrahydropyridine.
| Compound Name | 3-piperidin-4-yl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 121437323 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-piperidin-4-yl-1,2,3,4-tetrahydropyridine |
| SMILES | C1=CNCC(C2CCNCC2)C1 |
| InChI | InChI=1S/C10H18N2/c1-2-10(8-12-5-1)9-3-6-11-7-4-9/h1,5,9-12H,2-4,6-8H2 |
| InChIKey | PIFSDVSYFQXPBU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |